Products 731802-53-2
CAS 731802-53-2 is the registry number for 7-Chloro-3-cyclopentyl-2-sulfanyl-3,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
7-chloro-3-cyclopentyl-2-sulfanylidene-1H-quinazolin-4-one (CAS 731802-53-2) is a chemical compound with the molecular formula C13H13ClN2OS and a molecular weight of 280.77 g/mol. IUPAC name: 7-chloro-3-cyclopentyl-2-sulfanylidene-1H-quinazolin-4-one. InChIKey: UXGKYYHKFCPZGH-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2OS |
|---|---|
| Molecular weight | 280.77 g/mol |
| IUPAC name | 7-chloro-3-cyclopentyl-2-sulfanylidene-1H-quinazolin-4-one |
| InChIKey | UXGKYYHKFCPZGH-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2C(=O)C3=C(C=C(C=C3)Cl)NC2=S |
Computed by PubChem (NCBI)