CAS 4038-15-7 is the registry number for 2,4,4Prime-Trimethoxybenzophenone. Offered by: Biosynth. Available pack sizes: 2,5g, 0,25g.
(2,4-dimethoxyphenyl)-(4-methoxyphenyl)methanone (CAS 4038-15-7) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: (2,4-dimethoxyphenyl)-(4-methoxyphenyl)methanone. InChIKey: VFTDVICZBGDMMB-UHFFFAOYSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | (2,4-dimethoxyphenyl)-(4-methoxyphenyl)methanone |
| InChIKey | VFTDVICZBGDMMB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=C(C=C(C=C2)OC)OC |
Computed by PubChem (NCBI)