Products 40485-81-2
CAS 40485-81-2 is the registry number for Ethyl 4,5,6,7-tetrahydro-3,6-dimethyl-4-oxo-2-benzofurancarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 3,6-dimethyl-4-oxo-6,7-dihydro-5H-1-benzofuran-2-carboxylate (CAS 40485-81-2) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: ethyl 3,6-dimethyl-4-oxo-6,7-dihydro-5H-1-benzofuran-2-carboxylate. InChIKey: GYRKQAUUMSLNKW-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | ethyl 3,6-dimethyl-4-oxo-6,7-dihydro-5H-1-benzofuran-2-carboxylate |
| InChIKey | GYRKQAUUMSLNKW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(O1)CC(CC2=O)C)C |
Computed by PubChem (NCBI)