Products 405102-96-7

CAS 405102-96-7 is the registry number for 6-Methoxy-3,4-dihydro-2h-1-benzopyran-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

6-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid (CAS 405102-96-7) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 6-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid. InChIKey: AJPHXXMOQFVTFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O4
Molecular weight208.21 g/mol
IUPAC name6-methoxy-3,4-dihydro-2H-chromene-4-carboxylic acid
InChIKeyAJPHXXMOQFVTFQ-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)OCCC2C(=O)O

Computed by PubChem (NCBI)