CAS 405103-00-6 appears in our catalog under these names: 1-Tert-butyl 4-ethyl 1H-pyrazole-1,4-dicarboxylate, 1-tert-Butyl 4-ethyl 1H-pyrazole-1,4-dicarboxylate, 97%. Offered by: TRC, AmBeed. Available pack sizes: 1g, 5g.
1-O-tert-butyl 4-O-ethyl pyrazole-1,4-dicarboxylate (CAS 405103-00-6) is a chemical compound with the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl pyrazole-1,4-dicarboxylate. InChIKey: OHJCPQXLPDDCRI-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O4 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl pyrazole-1,4-dicarboxylate |
| InChIKey | OHJCPQXLPDDCRI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN(N=C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)