CAS 405103-19-7 appears in our catalog under these names: Thiochromane-4-carboxylic acid 1,1-dioxide, 95%, 1,1-dioxo-3,4-dihydro-2H-thiochromene-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
1,1-dioxo-3,4-dihydro-2H-thiochromene-4-carboxylic acid (CAS 405103-19-7) is a chemical compound with the molecular formula C10H10O4S and a molecular weight of 226.25 g/mol. IUPAC name: 1,1-dioxo-3,4-dihydro-2H-thiochromene-4-carboxylic acid. InChIKey: SIXDNAOJMRQGSG-UHFFFAOYSA-N.
| Molecular formula | C10H10O4S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | 1,1-dioxo-3,4-dihydro-2H-thiochromene-4-carboxylic acid |
| InChIKey | SIXDNAOJMRQGSG-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=CC=CC=C2C1C(=O)O |
Computed by PubChem (NCBI)