CAS 40545-67-3 appears in our catalog under these names: 4-(1,3-Dioxaindan-5-yl)-1H-pyrazol-5-amine, 95%, 4-(1,3-Dioxaindan-5-yl)-1H-pyrazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-amine (CAS 40545-67-3) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 4-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-amine. InChIKey: ZPYHIMNEDDIXBY-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 4-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-amine |
| InChIKey | ZPYHIMNEDDIXBY-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=C(NN=C3)N |
Computed by PubChem (NCBI)