Products 40581-15-5
CAS 40581-15-5 is the registry number for Saccharin Methacrylamide, >98.0%(HPLC)(T). Offered by: TCI. Available pack sizes: 1g, 5g.
2-(2-methylprop-2-enoyl)-1,1-dioxo-1,2-benzothiazol-3-one (CAS 40581-15-5) is a chemical compound with the molecular formula C11H9NO4S and a molecular weight of 251.26 g/mol. IUPAC name: 2-(2-methylprop-2-enoyl)-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: QQURNQUIJWYUBP-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4S |
|---|---|
| Molecular weight | 251.26 g/mol |
| IUPAC name | 2-(2-methylprop-2-enoyl)-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | QQURNQUIJWYUBP-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)N1C(=O)C2=CC=CC=C2S1(=O)=O |
Computed by PubChem (NCBI)