CAS 40620-00-6 appears in our catalog under these names: 3–chlorobenzofuran–2–carbaldehyde, 3-chloro-1-benzofuran-2-carbaldehyde. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 250mg.
3-chloro-1-benzofuran-2-carbaldehyde (CAS 40620-00-6) is a chemical compound with the molecular formula C9H5ClO2 and a molecular weight of 180.59 g/mol. IUPAC name: 3-chloro-1-benzofuran-2-carbaldehyde. InChIKey: LCUJMIJZIBBAAX-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO2 |
|---|---|
| Molecular weight | 180.59 g/mol |
| IUPAC name | 3-chloro-1-benzofuran-2-carbaldehyde |
| InChIKey | LCUJMIJZIBBAAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(O2)C=O)Cl |
Computed by PubChem (NCBI)