CAS 40620-53-9 is the registry number for (R)-2-Chloro-beta-hydroxybenzenepropanoic Acid. Offered by: TRC. Available pack sizes: 100mg.
(3R)-3-(2-chlorophenyl)-3-hydroxypropanoic acid (CAS 40620-53-9) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: (3R)-3-(2-chlorophenyl)-3-hydroxypropanoic acid. InChIKey: XDILSCIPACPCMZ-MRVPVSSYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | (3R)-3-(2-chlorophenyl)-3-hydroxypropanoic acid |
| InChIKey | XDILSCIPACPCMZ-MRVPVSSYSA-N |
| SMILES | C1=CC=C(C(=C1)[C@@H](CC(=O)O)O)Cl |
Computed by PubChem (NCBI)