CAS 40662-76-8 appears in our catalog under these names: 6–HYDROXY–4,4,5,7,8–PENTAMETHYL–3,4–DIHYDROCOUMARIN, 6-Hydroxy-4,4,5,7,8-pentamethylchroman-2-one, 95%, 95%, 6-HYDROXY-4,4,5,7,8-PENTAMETHYL-3,4-DIHYDROCOUMARIN, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
6-hydroxy-4,4,5,7,8-pentamethyl-3H-chromen-2-one (CAS 40662-76-8) is a chemical compound with the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. IUPAC name: 6-hydroxy-4,4,5,7,8-pentamethyl-3H-chromen-2-one. InChIKey: NWBXBARTRIEVKH-UHFFFAOYSA-N.
| Molecular formula | C14H18O3 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 6-hydroxy-4,4,5,7,8-pentamethyl-3H-chromen-2-one |
| InChIKey | NWBXBARTRIEVKH-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C(=C1O)C)C(CC(=O)O2)(C)C)C |
Computed by PubChem (NCBI)