Products 406927-72-8
CAS 406927-72-8 appears in our catalog under these names: 4-Methyl-3-m-tolylsulfamoyl-benzoic acid, 95%, 4-Methyl-3-((3-methylphenyl)sulfamoyl)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g.
4-methyl-3-[(3-methylphenyl)sulfamoyl]benzoic acid (CAS 406927-72-8) is a chemical compound with the molecular formula C15H15NO4S and a molecular weight of 305.4 g/mol. IUPAC name: 4-methyl-3-[(3-methylphenyl)sulfamoyl]benzoic acid. InChIKey: MKKMFXLAESXJNF-UHFFFAOYSA-N.
| Molecular formula | C15H15NO4S |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 4-methyl-3-[(3-methylphenyl)sulfamoyl]benzoic acid |
| InChIKey | MKKMFXLAESXJNF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NS(=O)(=O)C2=C(C=CC(=C2)C(=O)O)C |
Computed by PubChem (NCBI)