CAS 40787-96-0 appears in our catalog under these names: 3-Bromo-4-nitroaniline, 96%, 3-Bromo-4-nitroaniline 98%, 3-Bromo-4-nitroaniline, 98%, 98%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 250mg.
3-bromo-4-nitroaniline (CAS 40787-96-0) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 3-bromo-4-nitroaniline. InChIKey: RLAIFIDRVAAEBW-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 3-bromo-4-nitroaniline |
| InChIKey | RLAIFIDRVAAEBW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)