Products 409304-46-7
CAS 409304-46-7 is the registry number for 2-(3-(Chloromethyl)-1,2,4-oxadiazol-5-yl)phenol. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]phenol (CAS 409304-46-7) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: 2-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]phenol. InChIKey: ZGVJDSCNZFSKOG-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 2-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]phenol |
| InChIKey | ZGVJDSCNZFSKOG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=NO2)CCl)O |
Computed by PubChem (NCBI)