CAS 4097-61-4 is the registry number for 3,4-DIMETHYL-2,6-DINITROPHENOL, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
3,4-dimethyl-2,6-dinitrophenol (CAS 4097-61-4) is a chemical compound with the molecular formula C8H8N2O5 and a molecular weight of 212.16 g/mol. IUPAC name: 3,4-dimethyl-2,6-dinitrophenol. InChIKey: HWYUVFKGQPJIFG-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O5 |
|---|---|
| Molecular weight | 212.16 g/mol |
| IUPAC name | 3,4-dimethyl-2,6-dinitrophenol |
| InChIKey | HWYUVFKGQPJIFG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)[N+](=O)[O-])O)[N+](=O)[O-] |
Computed by PubChem (NCBI)