CAS 41040-24-8 appears in our catalog under these names: 4-Chloro-2,6-dimethyl-5h-pyrrolo[3,2-d]pyrimidine, 95%, 4-Chloro-2,6-dimethyl-5H-pyrrolo(3,2-d)pyrimidine, 97%, 4-Chloro-2,6-dimethyl-5h-pyrrolo[3,2-d]pyrimidine, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
4-chloro-2,6-dimethyl-5H-pyrrolo[3,2-d]pyrimidine (CAS 41040-24-8) is a chemical compound with the molecular formula C8H8ClN3 and a molecular weight of 181.62 g/mol. IUPAC name: 4-chloro-2,6-dimethyl-5H-pyrrolo[3,2-d]pyrimidine. InChIKey: CQNXCCXQBKWANP-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | 4-chloro-2,6-dimethyl-5H-pyrrolo[3,2-d]pyrimidine |
| InChIKey | CQNXCCXQBKWANP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)C(=NC(=N2)C)Cl |
Computed by PubChem (NCBI)