Products 41042-17-5
CAS 41042-17-5 is the registry number for 1-Phenethylindoline-2,3-dione, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2-phenylethyl)indole-2,3-dione (CAS 41042-17-5) is a chemical compound with the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. IUPAC name: 1-(2-phenylethyl)indole-2,3-dione. InChIKey: XICVNIWRISOITG-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 1-(2-phenylethyl)indole-2,3-dione |
| InChIKey | XICVNIWRISOITG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCN2C3=CC=CC=C3C(=O)C2=O |
Computed by PubChem (NCBI)
Synonyms:
1-phenethylindoline-2,3-dione, 1-(2-phenylethyl)-1H-indole-2,3-dione, 1-(2-phenylethyl)indole-2,3-dione, 1-(2-phenylethyl)-2,3-dihydro-1H-indole-2,3-dione, 1-Phenethyl-1H-indole-2,3-dione, 1-(2-Phenylethyl)isatin, CBMicro_013192, N-phenethylisatin, 1-(2-phenylethyl)benzo[d]azoline-2,3-dione