CAS 41097-65-8 is the registry number for (E)-1-benzylidene-2-phenylhydrazine. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(E)-benzylideneamino]aniline (CAS 41097-65-8) is a chemical compound with the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. IUPAC name: N-[(E)-benzylideneamino]aniline. InChIKey: JGOAZQAXRONCCI-SDNWHVSQSA-N.
| Molecular formula | C13H12N2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | N-[(E)-benzylideneamino]aniline |
| InChIKey | JGOAZQAXRONCCI-SDNWHVSQSA-N |
| SMILES | C1=CC=C(C=C1)/C=N/NC2=CC=CC=C2 |
Computed by PubChem (NCBI)