CAS 41137-85-3 is the registry number for Platyphyllonol. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1 mg.
(5S)-5-hydroxy-1,7-bis(4-hydroxyphenyl)heptan-3-one (CAS 41137-85-3) is a chemical compound with the molecular formula C19H22O4 and a molecular weight of 314.4 g/mol. IUPAC name: (5S)-5-hydroxy-1,7-bis(4-hydroxyphenyl)heptan-3-one. InChIKey: ZBFSUZGUYFFWGY-SFHVURJKSA-N.
| Molecular formula | C19H22O4 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | (5S)-5-hydroxy-1,7-bis(4-hydroxyphenyl)heptan-3-one |
| InChIKey | ZBFSUZGUYFFWGY-SFHVURJKSA-N |
| SMILES | C1=CC(=CC=C1CC[C@@H](CC(=O)CCC2=CC=C(C=C2)O)O)O |
Computed by PubChem (NCBI)