Products 41167-74-2
CAS 41167-74-2 is the registry number for N-(4-Bromophenyl)succinimide, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 25g.
1-(4-bromophenyl)pyrrolidine-2,5-dione (CAS 41167-74-2) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 1-(4-bromophenyl)pyrrolidine-2,5-dione. InChIKey: QDJNZUVVZSTBJL-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 1-(4-bromophenyl)pyrrolidine-2,5-dione |
| InChIKey | QDJNZUVVZSTBJL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)