Products 41263-65-4
CAS 41263-65-4 appears in our catalog under these names: 4-amino-3-nitrobenzamide, 4-Amino-3-nitrobenzamide, 98%, 4-Amino-3-nitrobenzamide, 98%, 98%. Offered by: Biosynth, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 10g, 250mg, 5g.
4-amino-3-nitrobenzamide (CAS 41263-65-4) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: 4-amino-3-nitrobenzamide. InChIKey: YLKLDLKLEXDSJY-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 4-amino-3-nitrobenzamide |
| InChIKey | YLKLDLKLEXDSJY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)N)[N+](=O)[O-])N |
Computed by PubChem (NCBI)