CAS 41270-69-3 appears in our catalog under these names: 6–Phenylpyrazin–2–amine, 6-Phenylpyrazin-2-amine 97%, 6-Phenylpyrazin-2-amine, 97%, 97%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-phenylpyrazin-2-amine (CAS 41270-69-3) is a chemical compound with the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. IUPAC name: 6-phenylpyrazin-2-amine. InChIKey: PSEVKGFJGGKCIX-UHFFFAOYSA-N.
| Molecular formula | C10H9N3 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | 6-phenylpyrazin-2-amine |
| InChIKey | PSEVKGFJGGKCIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=CC(=N2)N |
Computed by PubChem (NCBI)