Products 412931-82-9
CAS 412931-82-9 is the registry number for N-(4-Bromophenyl)-2-(cyclopent-2-en-1-yl)acetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-bromophenyl)-2-cyclopent-2-en-1-ylacetamide (CAS 412931-82-9) is a chemical compound with the molecular formula C13H14BrNO and a molecular weight of 280.16 g/mol. IUPAC name: N-(4-bromophenyl)-2-cyclopent-2-en-1-ylacetamide. InChIKey: KNZDWSZSUKWEKE-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO |
|---|---|
| Molecular weight | 280.16 g/mol |
| IUPAC name | N-(4-bromophenyl)-2-cyclopent-2-en-1-ylacetamide |
| InChIKey | KNZDWSZSUKWEKE-UHFFFAOYSA-N |
| SMILES | C1CC(C=C1)CC(=O)NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)