CAS 843620-91-7 is the registry number for 2-Bromo-1-(2,6-dimethyl-1h-indol-3-yl)propan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-bromo-1-(2,6-dimethyl-1H-indol-3-yl)propan-1-one (CAS 843620-91-7) is a chemical compound with the molecular formula C13H14BrNO and a molecular weight of 280.16 g/mol. IUPAC name: 2-bromo-1-(2,6-dimethyl-1H-indol-3-yl)propan-1-one. InChIKey: JZURJGJLYVEGCA-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO |
|---|---|
| Molecular weight | 280.16 g/mol |
| IUPAC name | 2-bromo-1-(2,6-dimethyl-1H-indol-3-yl)propan-1-one |
| InChIKey | JZURJGJLYVEGCA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=C(N2)C)C(=O)C(C)Br |
Computed by PubChem (NCBI)