CAS 1784426-27-2 is the registry number for 6'-Bromo-2',3'-dihydro-1'H-spiro[cyclopentane-1,4'-isoquinolin]-1'-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromospiro[2,3-dihydroisoquinoline-4,1'-cyclopentane]-1-one (CAS 1784426-27-2) is a chemical compound with the molecular formula C13H14BrNO and a molecular weight of 280.16 g/mol. IUPAC name: 6-bromospiro[2,3-dihydroisoquinoline-4,1'-cyclopentane]-1-one. InChIKey: LXEFTJMTICDDQG-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO |
|---|---|
| Molecular weight | 280.16 g/mol |
| IUPAC name | 6-bromospiro[2,3-dihydroisoquinoline-4,1'-cyclopentane]-1-one |
| InChIKey | LXEFTJMTICDDQG-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)CNC(=O)C3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)