CAS 2789682-72-8 is the registry number for 6'-Bromo-2'-methylspiro[cyclopentane-1,1'-isoindolin]-3'-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5'-bromo-2'-methylspiro[cyclopentane-1,3'-isoindole]-1'-one (CAS 2789682-72-8) is a chemical compound with the molecular formula C13H14BrNO and a molecular weight of 280.16 g/mol. IUPAC name: 5'-bromo-2'-methylspiro[cyclopentane-1,3'-isoindole]-1'-one. InChIKey: ROAAWRKLPRSRIU-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO |
|---|---|
| Molecular weight | 280.16 g/mol |
| IUPAC name | 5'-bromo-2'-methylspiro[cyclopentane-1,3'-isoindole]-1'-one |
| InChIKey | ROAAWRKLPRSRIU-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=C(C13CCCC3)C=C(C=C2)Br |
Computed by PubChem (NCBI)