CAS 1132076-32-4 is the registry number for 2-(2-Bromobicyclo[4.2.0]octa-1,3,5-trien-7-yl)-4,4-dimethyl-4,5-dihydrooxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-bromo-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-4,4-dimethyl-5H-1,3-oxazole (CAS 1132076-32-4) is a chemical compound with the molecular formula C13H14BrNO and a molecular weight of 280.16 g/mol. IUPAC name: 2-(2-bromo-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-4,4-dimethyl-5H-1,3-oxazole. InChIKey: DCIKAJCPCNPBTG-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO |
|---|---|
| Molecular weight | 280.16 g/mol |
| IUPAC name | 2-(2-bromo-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-4,4-dimethyl-5H-1,3-oxazole |
| InChIKey | DCIKAJCPCNPBTG-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C2CC3=C2C=CC=C3Br)C |
Computed by PubChem (NCBI)