CAS 41303-44-0 is the registry number for 5-Butanoic acid 1,3-benzodioxole. Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g, 2g, 5g.
4-(1,3-benzodioxol-5-yl)butanoic acid (CAS 41303-44-0) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 4-(1,3-benzodioxol-5-yl)butanoic acid. InChIKey: DOVMVBWTRNTJOF-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 4-(1,3-benzodioxol-5-yl)butanoic acid |
| InChIKey | DOVMVBWTRNTJOF-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CCCC(=O)O |
Computed by PubChem (NCBI)