CAS 41306-76-7 is the registry number for 4-(1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl)butanethioamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-(1,3-dioxoisoindol-2-yl)butanethioamide (CAS 41306-76-7) is a chemical compound with the molecular formula C12H12N2O2S and a molecular weight of 248.30 g/mol. IUPAC name: 4-(1,3-dioxoisoindol-2-yl)butanethioamide. InChIKey: MAOSRRBZNPOFSB-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | 4-(1,3-dioxoisoindol-2-yl)butanethioamide |
| InChIKey | MAOSRRBZNPOFSB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCC(=S)N |
Computed by PubChem (NCBI)