CAS 413573-34-9 appears in our catalog under these names: N-Cyclopentyl-4-nitrobenzene-1-sulfonamide, 95%, N-Cyclopentyl-4-nitrobenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
N-cyclopentyl-4-nitrobenzenesulfonamide (CAS 413573-34-9) is a chemical compound with the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. IUPAC name: N-cyclopentyl-4-nitrobenzenesulfonamide. InChIKey: AHIDFHGCZZOGJB-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O4S |
|---|---|
| Molecular weight | 270.31 g/mol |
| IUPAC name | N-cyclopentyl-4-nitrobenzenesulfonamide |
| InChIKey | AHIDFHGCZZOGJB-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NS(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)