CAS 41373-96-0 appears in our catalog under these names: 3,6-Dichloro-4-phenylpyridazine, 97%, 3,6-Dichloro-4-phenylpyridazine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3,6-dichloro-4-phenylpyridazine (CAS 41373-96-0) is a chemical compound with the molecular formula C10H6Cl2N2 and a molecular weight of 225.07 g/mol. IUPAC name: 3,6-dichloro-4-phenylpyridazine. InChIKey: QEANUHPTLLPFPA-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 3,6-dichloro-4-phenylpyridazine |
| InChIKey | QEANUHPTLLPFPA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)