CAS 4138-23-2 appears in our catalog under these names: 1,2,3,4-Tetrahydroquinoline-3-carboxamide, 95%, 1,2,3,4-Tetrahydroquinoline-3-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1,2,3,4-tetrahydroquinoline-3-carboxamide (CAS 4138-23-2) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 1,2,3,4-tetrahydroquinoline-3-carboxamide. InChIKey: NYENCZIONJUOSQ-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1,2,3,4-tetrahydroquinoline-3-carboxamide |
| InChIKey | NYENCZIONJUOSQ-UHFFFAOYSA-N |
| SMILES | C1C(CNC2=CC=CC=C21)C(=O)N |
Computed by PubChem (NCBI)