Products 414892-26-5
CAS 414892-26-5 is the registry number for 1-((3,4-Dichlorophenyl)methyl)piperidin-3-ol. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-[(3,4-dichlorophenyl)methyl]piperidin-3-ol (CAS 414892-26-5) is a chemical compound with the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. IUPAC name: 1-[(3,4-dichlorophenyl)methyl]piperidin-3-ol. InChIKey: CGWXRMJZQYQZNH-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | 1-[(3,4-dichlorophenyl)methyl]piperidin-3-ol |
| InChIKey | CGWXRMJZQYQZNH-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC(=C(C=C2)Cl)Cl)O |
Computed by PubChem (NCBI)