Products 414909-09-4
CAS 414909-09-4 is the registry number for RTC14. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-tert-butyl-2-[(3-nitrophenyl)methylideneamino]phenol (CAS 414909-09-4) is a chemical compound with the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. IUPAC name: 4-tert-butyl-2-[(3-nitrophenyl)methylideneamino]phenol. InChIKey: SRROYBWFBCWHGV-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O3 |
|---|---|
| Molecular weight | 298.34 g/mol |
| IUPAC name | 4-tert-butyl-2-[(3-nitrophenyl)methylideneamino]phenol |
| InChIKey | SRROYBWFBCWHGV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)O)N=CC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)