CAS 865853-43-6 is the registry number for 1,2,5-Tri-O-acetyl-3-deoxy-D-ribofuranose. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg, 5000mg.
[(2S,4R)-4,5-diacetyloxyoxolan-2-yl]methyl acetate (CAS 865853-43-6) is a chemical compound with the molecular formula C11H16O7 and a molecular weight of 260.24 g/mol. IUPAC name: [(2S,4R)-4,5-diacetyloxyoxolan-2-yl]methyl acetate. InChIKey: MJDHNUNTWAOQPO-MTULOOOASA-N.
| Molecular formula | C11H16O7 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | [(2S,4R)-4,5-diacetyloxyoxolan-2-yl]methyl acetate |
| InChIKey | MJDHNUNTWAOQPO-MTULOOOASA-N |
| SMILES | CC(=O)OC[C@@H]1C[C@H](C(O1)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)