Products 415894-65-4
CAS 415894-65-4 is the registry number for 2-Chloro-N-(3-chloro-2,6-diethylphenyl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-(3-chloro-2,6-diethylphenyl)acetamide (CAS 415894-65-4) is a chemical compound with the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. IUPAC name: 2-chloro-N-(3-chloro-2,6-diethylphenyl)acetamide. InChIKey: ZEHVGJXELAOHNY-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | 2-chloro-N-(3-chloro-2,6-diethylphenyl)acetamide |
| InChIKey | ZEHVGJXELAOHNY-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=C(C=C1)Cl)CC)NC(=O)CCl |
Computed by PubChem (NCBI)