Products 415931-07-6
CAS 415931-07-6 appears in our catalog under these names: 1-[(3-Nitrophenyl)methyl]pyrrolidine, 95%, 1–(3–Nitrobenzyl)pyrrolidine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 100mg.
1-[(3-nitrophenyl)methyl]pyrrolidine (CAS 415931-07-6) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: 1-[(3-nitrophenyl)methyl]pyrrolidine. InChIKey: YLQHNPWMFVKRHS-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 1-[(3-nitrophenyl)methyl]pyrrolidine |
| InChIKey | YLQHNPWMFVKRHS-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)