CAS 41945-37-3 is the registry number for 3-Bromo-5,7-dimethylpyrazolo(1,5-a)pyrimidine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-bromo-5,7-dimethylpyrazolo[1,5-a]pyrimidine (CAS 41945-37-3) is a chemical compound with the molecular formula C8H8BrN3 and a molecular weight of 226.07 g/mol. IUPAC name: 3-bromo-5,7-dimethylpyrazolo[1,5-a]pyrimidine. InChIKey: WUPBXHOKESCXBJ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 3-bromo-5,7-dimethylpyrazolo[1,5-a]pyrimidine |
| InChIKey | WUPBXHOKESCXBJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C(C=NN12)Br)C |
Computed by PubChem (NCBI)