Products 420095-74-5
CAS 420095-74-5 is the registry number for Sodium 3-methyl-2-oxobutanoate-13C5,d1. Offered by: MedChemExpress. Available pack sizes: 1 mg.
Sodium 3-deuterio-3-(113C)methyl-2-oxo(1,2,3,4-13C4)butanoate (CAS 420095-74-5) is a chemical compound with the molecular formula C5H7NaO3 and a molecular weight of 144.067 g/mol. IUPAC name: sodium 3-deuterio-3-(113C)methyl-2-oxo(1,2,3,4-13C4)butanoate. InChIKey: WIQBZDCJCRFGKA-MLIDLTAPSA-M.
| Molecular formula | C5H7NaO3 |
|---|---|
| Molecular weight | 144.067 g/mol |
| IUPAC name | sodium 3-deuterio-3-(113C)methyl-2-oxo(1,2,3,4-13C4)butanoate |
| InChIKey | WIQBZDCJCRFGKA-MLIDLTAPSA-M |
| SMILES | [2H][13C]([13CH3])([13CH3])[13C](=O)[13C](=O)[O-].[Na+] |
Computed by PubChem (NCBI)
Synonyms:
Sodium 3-methyl-2-oxobutanoate-13C5,d1, 2-Keto-3-methylbutyric acid-13C5,3-d1 sodium salt, Alpha-Ketoisovaleric Acid, Sodium Salt (13C5, 98%; 3-D1, 98%), sodium;3-deuterio-3-(113C)methyl-2-oxo(1,2,3,4-13C4)butanoate, 2-Keto-3-methylbutyric acid-13C5,3-d sodium salt, 98 atom % D, 99 atom % 13C