CAS 42039-85-0 is the registry number for oxanthren-2-ylmethanol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Dibenzo-p-dioxin-2-ylmethanol (CAS 42039-85-0) is a chemical compound with the molecular formula C13H10O3 and a molecular weight of 214.22 g/mol. IUPAC name: dibenzo-p-dioxin-2-ylmethanol. InChIKey: XNBMSPPLEHGBPK-UHFFFAOYSA-N.
| Molecular formula | C13H10O3 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | dibenzo-p-dioxin-2-ylmethanol |
| InChIKey | XNBMSPPLEHGBPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)OC3=C(O2)C=C(C=C3)CO |
Computed by PubChem (NCBI)