Products 42087-81-0
CAS 42087-81-0 appears in our catalog under these names: Methyl 3-chloro-2-nitrobenzoate, Methyl 3-chloro-2-nitrobenzoate 98%, Methyl 3-chloro-2-nitrobenzoate, 98%, 98%, Methyl 3-chloro-2-nitrobenzoate, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 50g, 100g, 250g, 250mg, 1g, 5g, 10g.
Methyl 3-chloro-2-nitrobenzoate (CAS 42087-81-0) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: methyl 3-chloro-2-nitrobenzoate. InChIKey: VTWUVGLVDQXCJO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | methyl 3-chloro-2-nitrobenzoate |
| InChIKey | VTWUVGLVDQXCJO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)