CAS 42327-95-7 appears in our catalog under these names: 2,2-Dimethyl-2,3-dihydrobenzofuran-7-carboxylic acid, 95+%, 2,2-Dimethyl-2,3-dihydro-1-benzofuran-7-carboxylic acid, 95%, 2,2-dimethyl-2,3-dihydro-1-benzofuran-7-carboxylic acid, 2,2-Dimethyl-2,3-dihydro-1-benzofuran-7-carboxylic acid, 97% . Offered by: AmBeed, Combi-blocks, Biosynth, Thermo Scientific. Available pack sizes: 5g, 250mg, 1g, 2,5g.
2,2-dimethyl-3H-1-benzofuran-7-carboxylic acid (CAS 42327-95-7) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 2,2-dimethyl-3H-1-benzofuran-7-carboxylic acid. InChIKey: AVVACPBRCFXZMR-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 2,2-dimethyl-3H-1-benzofuran-7-carboxylic acid |
| InChIKey | AVVACPBRCFXZMR-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C(=CC=C2)C(=O)O)C |
Computed by PubChem (NCBI)