CAS 42417-65-2 appears in our catalog under these names: (S)-N-(Benzyloxycarbonyl)-N-methylvaline, Z–N–Me–Val–OH, Z-L-MeVal-OH, Z-N-Me-Val-OH 97%, (S)-2-(((Benzyloxy)carbonyl)(methyl)amino)-3-methylbutanoic acid, 97%, 97%. Offered by: TRC, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g, 10g, 100g, 250mg, 10 g, 25 g.
(2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid (CAS 42417-65-2) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid. InChIKey: NNEHOKZDWLJKHP-LBPRGKRZSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2S)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid |
| InChIKey | NNEHOKZDWLJKHP-LBPRGKRZSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)N(C)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)