Products 92619-25-5

CAS 92619-25-5 appears in our catalog under these names: Cbz-N-methyl-DL-valine, 95%, 2-[[(Benzyloxy)carbonyl](methyl)amino]-3-methylbutanoic acid, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid (CAS 92619-25-5) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: 3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid. InChIKey: NNEHOKZDWLJKHP-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO4
Molecular weight265.30 g/mol
IUPAC name3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid
InChIKeyNNEHOKZDWLJKHP-UHFFFAOYSA-N
SMILESCC(C)C(C(=O)O)N(C)C(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)