CAS 53978-73-7 appears in our catalog under these names: Z-D-N-Me-Val-OH 95%, Z-D-N-Me-Val-OH, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g.
(2R)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid (CAS 53978-73-7) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (2R)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid. InChIKey: NNEHOKZDWLJKHP-GFCCVEGCSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2R)-3-methyl-2-[methyl(phenylmethoxycarbonyl)amino]butanoic acid |
| InChIKey | NNEHOKZDWLJKHP-GFCCVEGCSA-N |
| SMILES | CC(C)[C@H](C(=O)O)N(C)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)