Products 42472-90-2
CAS 42472-90-2 is the registry number for 2-(2-OXOPYRROLIDIN-3-YL)ISOINDOLINE-1,3-DIONE, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
2-(2-oxopyrrolidin-3-yl)isoindole-1,3-dione (CAS 42472-90-2) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: 2-(2-oxopyrrolidin-3-yl)isoindole-1,3-dione. InChIKey: MPQRVDQIKPBWMY-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 2-(2-oxopyrrolidin-3-yl)isoindole-1,3-dione |
| InChIKey | MPQRVDQIKPBWMY-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C1N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)