Products 42477-08-7
CAS 42477-08-7 is the registry number for 3-Chloro-n-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
3-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide (CAS 42477-08-7) is a chemical compound with the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. IUPAC name: 3-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide. InChIKey: YHRDEJFGHGFMHU-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO3 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | 3-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide |
| InChIKey | YHRDEJFGHGFMHU-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)NC(=O)CCCl |
Computed by PubChem (NCBI)