Products 424794-91-2
CAS 424794-91-2 is the registry number for Monoamine Oxidase B inhibitor 4. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(3,4-dichlorophenyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide (CAS 424794-91-2) is a chemical compound with the molecular formula C15H11Cl2NO3 and a molecular weight of 324.2 g/mol. IUPAC name: N-(3,4-dichlorophenyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide. InChIKey: QIJSOMHUEWLUNS-UHFFFAOYSA-N.
| Molecular formula | C15H11Cl2NO3 |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | N-(3,4-dichlorophenyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| InChIKey | QIJSOMHUEWLUNS-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(=O)NC3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)