Products 937604-95-0

CAS 937604-95-0 appears in our catalog under these names: 2-(2-(N-(2,4-Dichlorophenyl)carbamoyl)phenyl)acetic acid, 95%, 2-(2-(N-(2,4-Dichlorophenyl)carbamoyl)phenyl)acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 10g, 25g.

Structural formula: {0} (CAS {1})

2-[2-[(2,4-dichlorophenyl)carbamoyl]phenyl]acetic acid (CAS 937604-95-0) is a chemical compound with the molecular formula C15H11Cl2NO3 and a molecular weight of 324.2 g/mol. IUPAC name: 2-[2-[(2,4-dichlorophenyl)carbamoyl]phenyl]acetic acid. InChIKey: KMGIHAXAKXRFLZ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11Cl2NO3
Molecular weight324.2 g/mol
IUPAC name2-[2-[(2,4-dichlorophenyl)carbamoyl]phenyl]acetic acid
InChIKeyKMGIHAXAKXRFLZ-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)CC(=O)O)C(=O)NC2=C(C=C(C=C2)Cl)Cl

Computed by PubChem (NCBI)