Products 652129-89-0
CAS 652129-89-0 is the registry number for BTB01303. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4H-1,3-benzodioxin-6-yliminomethyl)-4,6-dichlorophenol (CAS 652129-89-0) is a chemical compound with the molecular formula C15H11Cl2NO3 and a molecular weight of 324.2 g/mol. IUPAC name: 2-(4H-1,3-benzodioxin-6-yliminomethyl)-4,6-dichlorophenol. InChIKey: VDRJYIIXTNQGDZ-UHFFFAOYSA-N.
| Molecular formula | C15H11Cl2NO3 |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | 2-(4H-1,3-benzodioxin-6-yliminomethyl)-4,6-dichlorophenol |
| InChIKey | VDRJYIIXTNQGDZ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)N=CC3=C(C(=CC(=C3)Cl)Cl)O)OCO1 |
Computed by PubChem (NCBI)
Synonyms:
Maybridge1_000841, orb2566762